C14H11Cl2NO2 — CID 141221396
3,5-dichloro-6-[(E)-2-(3-methoxyphenyl)ethenyl]-1H-pyridin-2-one (PubChem CID 141221396) has the molecular formula C14H11Cl2NO2 and a molecular weight of 296.15 g/mol. Its IUPAC name is 3,5-dichloro-6-[(E)-2-(3-methoxyphenyl)ethenyl]-1H-pyridin-2-one.
| Compound Name | 3,5-dichloro-6-[(E)-2-(3-methoxyphenyl)ethenyl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 141221396 |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 3,5-dichloro-6-[(E)-2-(3-methoxyphenyl)ethenyl]-1H-pyridin-2-one |
| SMILES | COc1cccc(/C=C/c2[nH]c(=O)c(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C14H11Cl2NO2/c1-19-10-4-2-3-9(7-10)5-6-13-11(15)8-12(16)14(18)17-13/h2-8H,1H3,(H,17,18)/b6-5+ |
| InChIKey | NLVBFKZEGKQPCF-AATRIKPKSA-N |
| XLogP | 3.86 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |