C28H29N5O3 — CID 141223961
N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]-9,10-dioxoanthracene-2-carboxamide (PubChem CID 141223961) has the molecular formula C28H29N5O3 and a molecular weight of 483.57 g/mol. Its IUPAC name is N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]-9,10-dioxoanthracene-2-carboxamide.
| Compound Name | N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]-9,10-dioxoanthracene-2-carboxamide |
|---|---|
| PubChem CID | 141223961 |
| Molecular Formula | C28H29N5O3 |
| Molecular Weight | 483.57 g/mol |
| Exact Mass | 483.23 |
| IUPAC Name | N-[4-[[6-(dimethylamino)-2-methylpyrimidin-4-yl]amino]cyclohexyl]-9,10-dioxoanthracene-2-carboxamide |
| SMILES | Cc1nc(NC2CCC(NC(=O)c3ccc4c(c3)C(=O)c3ccccc3C4=O)CC2)cc(N(C)C)n1 |
| InChI | InChI=1S/C28H29N5O3/c1-16-29-24(15-25(30-16)33(2)3)31-18-9-11-19(12-10-18)32-28(36)17-8-13-22-23(14-17)27(35)21-7-5-4-6-20(21)26(22)34/h4-8,13-15,18-19H,9-12H2,1-3H3,(H,32,36)(H,29,30,31) |
| InChIKey | DVEOOBDDKIQCSD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.57 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|