C21H30ClN5O — CID 141224005
6-N-[4-[2-(4-chlorophenoxy)ethylamino]cyclohexyl]-4-N,4-N,2-trimethylpyrimidine-4,6-diamine (PubChem CID 141224005) has the molecular formula C21H30ClN5O and a molecular weight of 403.96 g/mol. Its IUPAC name is 6-N-[4-[2-(4-chlorophenoxy)ethylamino]cyclohexyl]-4-N,4-N,2-trimethylpyrimidine-4,6-diamine.
| Compound Name | 6-N-[4-[2-(4-chlorophenoxy)ethylamino]cyclohexyl]-4-N,4-N,2-trimethylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 141224005 |
| Molecular Formula | C21H30ClN5O |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 6-N-[4-[2-(4-chlorophenoxy)ethylamino]cyclohexyl]-4-N,4-N,2-trimethylpyrimidine-4,6-diamine |
| SMILES | Cc1nc(NC2CCC(NCCOc3ccc(Cl)cc3)CC2)cc(N(C)C)n1 |
| InChI | InChI=1S/C21H30ClN5O/c1-15-24-20(14-21(25-15)27(2)3)26-18-8-6-17(7-9-18)23-12-13-28-19-10-4-16(22)5-11-19/h4-5,10-11,14,17-18,23H,6-9,12-13H2,1-3H3,(H,24,25,26) |
| InChIKey | XEIIQNZAAXARQN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|