About 1-cyclopropylpyrrol-2-ol
1-cyclopropylpyrrol-2-ol (PubChem CID 141224357) has the molecular formula C7H9NO
and a molecular weight of 123.15 g/mol. Its IUPAC name is 1-cyclopropylpyrrol-2-ol.
Molecular Properties
| Compound Name | 1-cyclopropylpyrrol-2-ol |
| PubChem CID | 141224357 |
| Molecular Formula | C7H9NO |
| Molecular Weight | 123.15 g/mol |
| Exact Mass | 123.07 |
| IUPAC Name | 1-cyclopropylpyrrol-2-ol |
| SMILES | Oc1cccn1C1CC1 |
| InChI | InChI=1S/C7H9NO/c9-7-2-1-5-8(7)6-3-4-6/h1-2,5-6,9H,3-4H2 |
| InChIKey | ODAHTDBLBCNGCF-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 123.15 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-cyclopropylpyrrol-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropylpyrrol-2-ol?
The IUPAC name of 1-cyclopropylpyrrol-2-ol (CID 141224357) is 1-cyclopropylpyrrol-2-ol.
What is the SMILES notation for 1-cyclopropylpyrrol-2-ol?
The canonical SMILES for 1-cyclopropylpyrrol-2-ol is Oc1cccn1C1CC1.
What is the InChIKey of 1-cyclopropylpyrrol-2-ol?
The InChIKey is ODAHTDBLBCNGCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO/c9-7-2-1-5-8(7)6-3-4-6/h1-2,5-6,9H,3-4H2.
What are the key properties of 1-cyclopropylpyrrol-2-ol?
1-cyclopropylpyrrol-2-ol has a molecular weight of 123.15 g/mol, XLogP of 1.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropylpyrrol-2-ol is sourced from PubChem (CID 141224357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).