C26H22N2O4P2S4 — CID 141224594
N,N'-bis(diphenoxyphosphinothioyl)ethanedithioamide (PubChem CID 141224594) has the molecular formula C26H22N2O4P2S4 and a molecular weight of 616.69 g/mol. Its IUPAC name is N,N'-bis(diphenoxyphosphinothioyl)ethanedithioamide.
| Compound Name | N,N'-bis(diphenoxyphosphinothioyl)ethanedithioamide |
|---|---|
| PubChem CID | 141224594 |
| Molecular Formula | C26H22N2O4P2S4 |
| Molecular Weight | 616.69 g/mol |
| Exact Mass | 615.99 |
| IUPAC Name | N,N'-bis(diphenoxyphosphinothioyl)ethanedithioamide |
| SMILES | S=C(NP(=S)(Oc1ccccc1)Oc1ccccc1)C(=S)NP(=S)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C26H22N2O4P2S4/c35-25(27-33(37,29-21-13-5-1-6-14-21)30-22-15-7-2-8-16-22)26(36)28-34(38,31-23-17-9-3-10-18-23)32-24-19-11-4-12-20-24/h1-20H,(H,27,35,37)(H,28,36,38) |
| InChIKey | AJSIRLDSMWAZAT-UHFFFAOYSA-N |
| XLogP | 7.59 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.69 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|