About hydroxy-imino-diphenoxy-λ5-phosphane
hydroxy-imino-diphenoxy-λ5-phosphane (PubChem CID 57044355) has the molecular formula C12H12NO3P
and a molecular weight of 249.21 g/mol. Its IUPAC name is hydroxy-imino-diphenoxy-λ5-phosphane.
Molecular Properties
| Compound Name | hydroxy-imino-diphenoxy-λ5-phosphane |
| PubChem CID | 57044355 |
| Molecular Formula | C12H12NO3P |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | hydroxy-imino-diphenoxy-λ5-phosphane |
| SMILES | [H]N=P(O)(Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C12H12NO3P/c13-17(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H,(H2,13,14) |
| InChIKey | QWMUDOFWQWBHFI-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hydroxy-imino-diphenoxy-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydroxy-imino-diphenoxy-λ5-phosphane?
The IUPAC name of hydroxy-imino-diphenoxy-λ5-phosphane (CID 57044355) is hydroxy-imino-diphenoxy-λ5-phosphane.
What is the SMILES notation for hydroxy-imino-diphenoxy-λ5-phosphane?
The canonical SMILES for hydroxy-imino-diphenoxy-λ5-phosphane is [H]N=P(O)(Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of hydroxy-imino-diphenoxy-λ5-phosphane?
The InChIKey is QWMUDOFWQWBHFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12NO3P/c13-17(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H,(H2,13,14).
What are the key properties of hydroxy-imino-diphenoxy-λ5-phosphane?
hydroxy-imino-diphenoxy-λ5-phosphane has a molecular weight of 249.21 g/mol, XLogP of 3.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydroxy-imino-diphenoxy-λ5-phosphane is sourced from PubChem (CID 57044355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).