C21H16FN5O5S2 — CID 141225924
5-[[4-(6-amino-7-fluoro-1-oxoisoquinolin-2-yl)phenyl]carbamoylsulfamoyl]thiophene-2-carboxamide (PubChem CID 141225924) has the molecular formula C21H16FN5O5S2 and a molecular weight of 501.52 g/mol. Its IUPAC name is 5-[[4-(6-amino-7-fluoro-1-oxoisoquinolin-2-yl)phenyl]carbamoylsulfamoyl]thiophene-2-carboxamide.
| Compound Name | 5-[[4-(6-amino-7-fluoro-1-oxoisoquinolin-2-yl)phenyl]carbamoylsulfamoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 141225924 |
| Molecular Formula | C21H16FN5O5S2 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 5-[[4-(6-amino-7-fluoro-1-oxoisoquinolin-2-yl)phenyl]carbamoylsulfamoyl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(S(=O)(=O)NC(=O)Nc2ccc(-n3ccc4cc(N)c(F)cc4c3=O)cc2)s1 |
| InChI | InChI=1S/C21H16FN5O5S2/c22-15-10-14-11(9-16(15)23)7-8-27(20(14)29)13-3-1-12(2-4-13)25-21(30)26-34(31,32)18-6-5-17(33-18)19(24)28/h1-10H,23H2,(H2,24,28)(H2,25,26,30) |
| InChIKey | VSOGEOMKCMAXJD-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 166.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|