C21H17N3O4S3 — CID 71072410
1-(5-methylthiophen-2-yl)sulfonyl-3-[4-(1-oxo-7-sulfanylisoquinolin-2-yl)phenyl]urea (PubChem CID 71072410) has the molecular formula C21H17N3O4S3 and a molecular weight of 471.59 g/mol. Its IUPAC name is 1-(5-methylthiophen-2-yl)sulfonyl-3-[4-(1-oxo-7-sulfanylisoquinolin-2-yl)phenyl]urea.
| Compound Name | 1-(5-methylthiophen-2-yl)sulfonyl-3-[4-(1-oxo-7-sulfanylisoquinolin-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 71072410 |
| Molecular Formula | C21H17N3O4S3 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.04 |
| IUPAC Name | 1-(5-methylthiophen-2-yl)sulfonyl-3-[4-(1-oxo-7-sulfanylisoquinolin-2-yl)phenyl]urea |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2ccc(-n3ccc4ccc(S)cc4c3=O)cc2)s1 |
| InChI | InChI=1S/C21H17N3O4S3/c1-13-2-9-19(30-13)31(27,28)23-21(26)22-15-4-6-16(7-5-15)24-11-10-14-3-8-17(29)12-18(14)20(24)25/h2-12,29H,1H3,(H2,22,23,26) |
| InChIKey | UDQIYYNBUOOFNE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|