C13H5BrF2O2 — CID 141227878
1-bromo-3,4-difluorobenzo[c]chromen-6-one (PubChem CID 141227878) has the molecular formula C13H5BrF2O2 and a molecular weight of 311.08 g/mol. Its IUPAC name is 1-bromo-3,4-difluorobenzo[c]chromen-6-one.
| Compound Name | 1-bromo-3,4-difluorobenzo[c]chromen-6-one |
|---|---|
| PubChem CID | 141227878 |
| Molecular Formula | C13H5BrF2O2 |
| Molecular Weight | 311.08 g/mol |
| Exact Mass | 309.94 |
| IUPAC Name | 1-bromo-3,4-difluorobenzo[c]chromen-6-one |
| SMILES | O=c1oc2c(F)c(F)cc(Br)c2c2ccccc12 |
| InChI | InChI=1S/C13H5BrF2O2/c14-8-5-9(15)11(16)12-10(8)6-3-1-2-4-7(6)13(17)18-12/h1-5H |
| InChIKey | VJMDOLVXQOEPQI-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.08 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|