About 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate
2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate (PubChem CID 141228778) has the molecular formula C24H46O7
and a molecular weight of 446.63 g/mol. Its IUPAC name is 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate.
Molecular Properties
| Compound Name | 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate |
| PubChem CID | 141228778 |
| Molecular Formula | C24H46O7 |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.32 |
| IUPAC Name | 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate |
| SMILES | CC(C)CCCCC(=O)OCCOCCOCCOCCOC(=O)CCCCC(C)C |
| InChI | InChI=1S/C24H46O7/c1-21(2)9-5-7-11-23(25)30-19-17-28-15-13-27-14-16-29-18-20-31-24(26)12-8-6-10-22(3)4/h21-22H,5-20H2,1-4H3 |
| InChIKey | RPGCQRYGRLCEAH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate?
The IUPAC name of 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate (CID 141228778) is 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate.
What is the SMILES notation for 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate?
The canonical SMILES for 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate is CC(C)CCCCC(=O)OCCOCCOCCOCCOC(=O)CCCCC(C)C.
What is the InChIKey of 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate?
The InChIKey is RPGCQRYGRLCEAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H46O7/c1-21(2)9-5-7-11-23(25)30-19-17-28-15-13-27-14-16-29-18-20-31-24(26)12-8-6-10-22(3)4/h21-22H,5-20H2,1-4H3.
What are the key properties of 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate?
2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate has a molecular weight of 446.63 g/mol, XLogP of 4.56, 22 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-[2-[2-(6-methylheptanoyloxy)ethoxy]ethoxy]ethoxy]ethyl 6-methylheptanoate is sourced from PubChem (CID 141228778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).