C20H18Cl3FO4S — CID 141229641
4-[4-(4-fluorophenyl)sulfanyl-2-(2,2,2-trichloroethoxycarbonyl)butyl]benzoic acid (PubChem CID 141229641) has the molecular formula C20H18Cl3FO4S and a molecular weight of 479.78 g/mol. Its IUPAC name is 4-[4-(4-fluorophenyl)sulfanyl-2-(2,2,2-trichloroethoxycarbonyl)butyl]benzoic acid.
| Compound Name | 4-[4-(4-fluorophenyl)sulfanyl-2-(2,2,2-trichloroethoxycarbonyl)butyl]benzoic acid |
|---|---|
| PubChem CID | 141229641 |
| Molecular Formula | C20H18Cl3FO4S |
| Molecular Weight | 479.78 g/mol |
| Exact Mass | 478.00 |
| IUPAC Name | 4-[4-(4-fluorophenyl)sulfanyl-2-(2,2,2-trichloroethoxycarbonyl)butyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC(CCSc2ccc(F)cc2)C(=O)OCC(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C20H18Cl3FO4S/c21-20(22,23)12-28-19(27)15(9-10-29-17-7-5-16(24)6-8-17)11-13-1-3-14(4-2-13)18(25)26/h1-8,15H,9-12H2,(H,25,26) |
| InChIKey | AIIOVWQRIZWPRW-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.78 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|