About 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone
2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone (PubChem CID 141231280) has the molecular formula C24H20AsBrOS
and a molecular weight of 511.32 g/mol. Its IUPAC name is 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone.
Molecular Properties
| Compound Name | 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone |
| PubChem CID | 141231280 |
| Molecular Formula | C24H20AsBrOS |
| Molecular Weight | 511.32 g/mol |
| Exact Mass | 509.96 |
| IUPAC Name | 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone |
| SMILES | O=C(C[As](Br)(c1ccccc1)(c1ccccc1)c1ccccc1)c1cccs1 |
| InChI | InChI=1S/C24H20AsBrOS/c26-25(20-11-4-1-5-12-20,21-13-6-2-7-14-21,22-15-8-3-9-16-22)19-23(27)24-17-10-18-28-24/h1-18H,19H2 |
| InChIKey | ZYFAILATUPWXHE-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 511.32 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone?
The IUPAC name of 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone (CID 141231280) is 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone.
What is the SMILES notation for 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone?
The canonical SMILES for 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone is O=C(C[As](Br)(c1ccccc1)(c1ccccc1)c1ccccc1)c1cccs1.
What is the InChIKey of 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone?
The InChIKey is ZYFAILATUPWXHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20AsBrOS/c26-25(20-11-4-1-5-12-20,21-13-6-2-7-14-21,22-15-8-3-9-16-22)19-23(27)24-17-10-18-28-24/h1-18H,19H2.
What are the key properties of 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone?
2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone has a molecular weight of 511.32 g/mol, XLogP of 4.95, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bromo(triphenyl)-λ5-arsanyl]-1-thiophen-2-ylethanone is sourced from PubChem (CID 141231280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).