C32H25NO5 — CID 141231687
2-[4-(2-benzoyl-6,7-dihydro-5H-furo[3,2-g]chromen-3-yl)phenoxy]-N-phenylacetamide (PubChem CID 141231687) has the molecular formula C32H25NO5 and a molecular weight of 503.55 g/mol. Its IUPAC name is 2-[4-(2-benzoyl-6,7-dihydro-5H-furo[3,2-g]chromen-3-yl)phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-(2-benzoyl-6,7-dihydro-5H-furo[3,2-g]chromen-3-yl)phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 141231687 |
| Molecular Formula | C32H25NO5 |
| Molecular Weight | 503.55 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | 2-[4-(2-benzoyl-6,7-dihydro-5H-furo[3,2-g]chromen-3-yl)phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc(-c2c(C(=O)c3ccccc3)oc3cc4c(cc23)CCCO4)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C32H25NO5/c34-29(33-24-11-5-2-6-12-24)20-37-25-15-13-21(14-16-25)30-26-18-23-10-7-17-36-27(23)19-28(26)38-32(30)31(35)22-8-3-1-4-9-22/h1-6,8-9,11-16,18-19H,7,10,17,20H2,(H,33,34) |
| InChIKey | XWIDRYRQJIAMEK-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.55 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |