C11H8ClNO2 — CID 141232207
(2Z)-1-(4-chlorophenyl)-2-(5H-1,3-oxazol-2-ylidene)ethanone (PubChem CID 141232207) has the molecular formula C11H8ClNO2 and a molecular weight of 221.64 g/mol. Its IUPAC name is (2Z)-1-(4-chlorophenyl)-2-(5H-1,3-oxazol-2-ylidene)ethanone.
| Compound Name | (2Z)-1-(4-chlorophenyl)-2-(5H-1,3-oxazol-2-ylidene)ethanone |
|---|---|
| PubChem CID | 141232207 |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.64 g/mol |
| Exact Mass | 221.02 |
| IUPAC Name | (2Z)-1-(4-chlorophenyl)-2-(5H-1,3-oxazol-2-ylidene)ethanone |
| SMILES | O=C(/C=C1/N=CCO1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H8ClNO2/c12-9-3-1-8(2-4-9)10(14)7-11-13-5-6-15-11/h1-5,7H,6H2/b11-7- |
| InChIKey | KOAABLSMRNTPLP-XFFZJAGNSA-N |
| XLogP | 2.47 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.64 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|