C16H19F3O2S — CID 141233866
5-methylsulfanyl-7-[2-methyl-1-[3-(trifluoromethyl)oxiran-2-yl]propan-2-yl]-2,3-dihydro-1-benzofuran (PubChem CID 141233866) has the molecular formula C16H19F3O2S and a molecular weight of 332.39 g/mol. Its IUPAC name is 5-methylsulfanyl-7-[2-methyl-1-[3-(trifluoromethyl)oxiran-2-yl]propan-2-yl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-methylsulfanyl-7-[2-methyl-1-[3-(trifluoromethyl)oxiran-2-yl]propan-2-yl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 141233866 |
| Molecular Formula | C16H19F3O2S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 5-methylsulfanyl-7-[2-methyl-1-[3-(trifluoromethyl)oxiran-2-yl]propan-2-yl]-2,3-dihydro-1-benzofuran |
| SMILES | CSc1cc2c(c(C(C)(C)CC3OC3C(F)(F)F)c1)OCC2 |
| InChI | InChI=1S/C16H19F3O2S/c1-15(2,8-12-14(21-12)16(17,18)19)11-7-10(22-3)6-9-4-5-20-13(9)11/h6-7,12,14H,4-5,8H2,1-3H3 |
| InChIKey | PVEBYZSHJROGTK-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|