About [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate
[5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate (PubChem CID 141235372) has the molecular formula C20H15ClO6
and a molecular weight of 386.79 g/mol. Its IUPAC name is [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate.
Molecular Properties
| Compound Name | [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate |
| PubChem CID | 141235372 |
| Molecular Formula | C20H15ClO6 |
| Molecular Weight | 386.79 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate |
| SMILES | CCOC(=O)/C=C/c1cc2ccoc2c(O)c1OC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H15ClO6/c1-2-25-16(22)8-5-13-11-14-9-10-26-18(14)17(23)19(13)27-20(24)12-3-6-15(21)7-4-12/h3-11,23H,2H2,1H3/b8-5+ |
| InChIKey | DDCVAAQTOWYYRH-VMPITWQZSA-N |
| XLogP | 4.59 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 386.79 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate?
The IUPAC name of [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate (CID 141235372) is [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate.
What is the SMILES notation for [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate?
The canonical SMILES for [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate is CCOC(=O)/C=C/c1cc2ccoc2c(O)c1OC(=O)c1ccc(Cl)cc1.
What is the InChIKey of [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate?
The InChIKey is DDCVAAQTOWYYRH-VMPITWQZSA-N. The full InChI is InChI=1S/C20H15ClO6/c1-2-25-16(22)8-5-13-11-14-9-10-26-18(14)17(23)19(13)27-20(24)12-3-6-15(21)7-4-12/h3-11,23H,2H2,1H3/b8-5+.
What are the key properties of [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate?
[5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate has a molecular weight of 386.79 g/mol, XLogP of 4.59, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[(E)-3-ethoxy-3-oxoprop-1-enyl]-7-hydroxy-1-benzofuran-6-yl] 4-chlorobenzoate is sourced from PubChem (CID 141235372), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).