C28H44O5S2 — CID 141235577
decyl (5S)-5-hydroxy-6-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]-3-oxohexanoate (PubChem CID 141235577) has the molecular formula C28H44O5S2 and a molecular weight of 524.79 g/mol. Its IUPAC name is decyl (5S)-5-hydroxy-6-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]-3-oxohexanoate.
| Compound Name | decyl (5S)-5-hydroxy-6-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]-3-oxohexanoate |
|---|---|
| PubChem CID | 141235577 |
| Molecular Formula | C28H44O5S2 |
| Molecular Weight | 524.79 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | decyl (5S)-5-hydroxy-6-[2-[2-(4-hydroxyphenyl)ethyl]-1,3-dithian-2-yl]-3-oxohexanoate |
| SMILES | CCCCCCCCCCOC(=O)CC(=O)C[C@H](O)CC1(CCc2ccc(O)cc2)SCCCS1 |
| InChI | InChI=1S/C28H44O5S2/c1-2-3-4-5-6-7-8-9-17-33-27(32)21-25(30)20-26(31)22-28(34-18-10-19-35-28)16-15-23-11-13-24(29)14-12-23/h11-14,26,29,31H,2-10,15-22H2,1H3/t26-/m0/s1 |
| InChIKey | GEHYWZGQKCLQDJ-SANMLTNESA-N |
| XLogP | 6.68 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.79 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|