C12H16O2 — CID 141236572
5-methoxy-2,2-dimethyl-3a,4-dihydro-3H-inden-1-one (PubChem CID 141236572) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 5-methoxy-2,2-dimethyl-3a,4-dihydro-3H-inden-1-one.
| Compound Name | 5-methoxy-2,2-dimethyl-3a,4-dihydro-3H-inden-1-one |
|---|---|
| PubChem CID | 141236572 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 5-methoxy-2,2-dimethyl-3a,4-dihydro-3H-inden-1-one |
| SMILES | COC1=CC=C2C(=O)C(C)(C)CC2C1 |
| InChI | InChI=1S/C12H16O2/c1-12(2)7-8-6-9(14-3)4-5-10(8)11(12)13/h4-5,8H,6-7H2,1-3H3 |
| InChIKey | MQOGXMUYSSJNDI-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |