C13H26Br2O2 — CID 141237047
13,13-dibromotridecane-5,5-diol (PubChem CID 141237047) has the molecular formula C13H26Br2O2 and a molecular weight of 374.16 g/mol. Its IUPAC name is 13,13-dibromotridecane-5,5-diol.
| Compound Name | 13,13-dibromotridecane-5,5-diol |
|---|---|
| PubChem CID | 141237047 |
| Molecular Formula | C13H26Br2O2 |
| Molecular Weight | 374.16 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | 13,13-dibromotridecane-5,5-diol |
| SMILES | CCCCC(O)(O)CCCCCCCC(Br)Br |
| InChI | InChI=1S/C13H26Br2O2/c1-2-3-10-13(16,17)11-8-6-4-5-7-9-12(14)15/h12,16-17H,2-11H2,1H3 |
| InChIKey | DRNFVDUPBQJRSF-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.16 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|