C7H5F6N — CID 141238199
4,6-bis(trifluoromethyl)-2,3-dihydropyridine (PubChem CID 141238199) has the molecular formula C7H5F6N and a molecular weight of 217.11 g/mol. Its IUPAC name is 4,6-bis(trifluoromethyl)-2,3-dihydropyridine.
| Compound Name | 4,6-bis(trifluoromethyl)-2,3-dihydropyridine |
|---|---|
| PubChem CID | 141238199 |
| Molecular Formula | C7H5F6N |
| Molecular Weight | 217.11 g/mol |
| Exact Mass | 217.03 |
| IUPAC Name | 4,6-bis(trifluoromethyl)-2,3-dihydropyridine |
| SMILES | FC(F)(F)C1=CC(C(F)(F)F)=NCC1 |
| InChI | InChI=1S/C7H5F6N/c8-6(9,10)4-1-2-14-5(3-4)7(11,12)13/h3H,1-2H2 |
| InChIKey | CZTTWKSRGXTTTA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.11 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |