C13H17BrN4O2 — CID 141239404
2-[(6-bromo-2-tert-butylimidazo[1,2-a]pyridin-3-yl)amino]-N-hydroxyacetamide (PubChem CID 141239404) has the molecular formula C13H17BrN4O2 and a molecular weight of 341.21 g/mol. Its IUPAC name is 2-[(6-bromo-2-tert-butylimidazo[1,2-a]pyridin-3-yl)amino]-N-hydroxyacetamide.
| Compound Name | 2-[(6-bromo-2-tert-butylimidazo[1,2-a]pyridin-3-yl)amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 141239404 |
| Molecular Formula | C13H17BrN4O2 |
| Molecular Weight | 341.21 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 2-[(6-bromo-2-tert-butylimidazo[1,2-a]pyridin-3-yl)amino]-N-hydroxyacetamide |
| SMILES | CC(C)(C)c1nc2ccc(Br)cn2c1NCC(=O)NO |
| InChI | InChI=1S/C13H17BrN4O2/c1-13(2,3)11-12(15-6-10(19)17-20)18-7-8(14)4-5-9(18)16-11/h4-5,7,15,20H,6H2,1-3H3,(H,17,19) |
| InChIKey | VMNYGFCCECODIW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|