C13H15BrN4O4 — CID 141239233
3-[6-bromo-3-[[2-(hydroxyamino)-2-oxoethyl]amino]-5-methylimidazo[1,2-a]pyridin-2-yl]propanoic acid (PubChem CID 141239233) has the molecular formula C13H15BrN4O4 and a molecular weight of 371.19 g/mol. Its IUPAC name is 3-[6-bromo-3-[[2-(hydroxyamino)-2-oxoethyl]amino]-5-methylimidazo[1,2-a]pyridin-2-yl]propanoic acid.
| Compound Name | 3-[6-bromo-3-[[2-(hydroxyamino)-2-oxoethyl]amino]-5-methylimidazo[1,2-a]pyridin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 141239233 |
| Molecular Formula | C13H15BrN4O4 |
| Molecular Weight | 371.19 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | 3-[6-bromo-3-[[2-(hydroxyamino)-2-oxoethyl]amino]-5-methylimidazo[1,2-a]pyridin-2-yl]propanoic acid |
| SMILES | Cc1c(Br)ccc2nc(CCC(=O)O)c(NCC(=O)NO)n12 |
| InChI | InChI=1S/C13H15BrN4O4/c1-7-8(14)2-4-10-16-9(3-5-12(20)21)13(18(7)10)15-6-11(19)17-22/h2,4,15,22H,3,5-6H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | VPCHCBKCSORVNA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 115.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.19 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|