C16H24N4O2 — CID 141239377
2-[(2-butyl-5-propylimidazo[1,2-a]pyridin-3-yl)amino]-N-hydroxyacetamide (PubChem CID 141239377) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 2-[(2-butyl-5-propylimidazo[1,2-a]pyridin-3-yl)amino]-N-hydroxyacetamide.
| Compound Name | 2-[(2-butyl-5-propylimidazo[1,2-a]pyridin-3-yl)amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 141239377 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 2-[(2-butyl-5-propylimidazo[1,2-a]pyridin-3-yl)amino]-N-hydroxyacetamide |
| SMILES | CCCCc1nc2cccc(CCC)n2c1NCC(=O)NO |
| InChI | InChI=1S/C16H24N4O2/c1-3-5-9-13-16(17-11-15(21)19-22)20-12(7-4-2)8-6-10-14(20)18-13/h6,8,10,17,22H,3-5,7,9,11H2,1-2H3,(H,19,21) |
| InChIKey | NJWYMWYFRXKNEU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|