C18H22N4O3 — CID 141239385
N-hydroxy-2-[(9-hydroxy-2-pentylimidazo[1,2-a]quinolin-1-yl)amino]acetamide (PubChem CID 141239385) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-hydroxy-2-[(9-hydroxy-2-pentylimidazo[1,2-a]quinolin-1-yl)amino]acetamide.
| Compound Name | N-hydroxy-2-[(9-hydroxy-2-pentylimidazo[1,2-a]quinolin-1-yl)amino]acetamide |
|---|---|
| PubChem CID | 141239385 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | N-hydroxy-2-[(9-hydroxy-2-pentylimidazo[1,2-a]quinolin-1-yl)amino]acetamide |
| SMILES | CCCCCc1nc2ccc3cccc(O)c3n2c1NCC(=O)NO |
| InChI | InChI=1S/C18H22N4O3/c1-2-3-4-7-13-18(19-11-16(24)21-25)22-15(20-13)10-9-12-6-5-8-14(23)17(12)22/h5-6,8-10,19,23,25H,2-4,7,11H2,1H3,(H,21,24) |
| InChIKey | PDPFHIVBVSEKSM-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 98.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|