C16H19N5O4 — CID 141241082
2-[(3-hept-1-ynyl-6-nitroimidazo[1,2-a]pyridin-2-yl)amino]-N-hydroxyacetamide (PubChem CID 141241082) has the molecular formula C16H19N5O4 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-[(3-hept-1-ynyl-6-nitroimidazo[1,2-a]pyridin-2-yl)amino]-N-hydroxyacetamide.
| Compound Name | 2-[(3-hept-1-ynyl-6-nitroimidazo[1,2-a]pyridin-2-yl)amino]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 141241082 |
| Molecular Formula | C16H19N5O4 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[(3-hept-1-ynyl-6-nitroimidazo[1,2-a]pyridin-2-yl)amino]-N-hydroxyacetamide |
| SMILES | CCCCCC#Cc1c(NCC(=O)NO)nc2ccc([N+](=O)[O-])cn12 |
| InChI | InChI=1S/C16H19N5O4/c1-2-3-4-5-6-7-13-16(17-10-15(22)19-23)18-14-9-8-12(21(24)25)11-20(13)14/h8-9,11,17,23H,2-5,10H2,1H3,(H,19,22) |
| InChIKey | XMROQBLREHDONO-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|