C15H18N4O5 — CID 82032789
2-[[2-(6-nitroimidazo[1,2-a]pyridin-2-yl)acetyl]amino]hexanoic acid (PubChem CID 82032789) has the molecular formula C15H18N4O5 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-[[2-(6-nitroimidazo[1,2-a]pyridin-2-yl)acetyl]amino]hexanoic acid.
| Compound Name | 2-[[2-(6-nitroimidazo[1,2-a]pyridin-2-yl)acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 82032789 |
| Molecular Formula | C15H18N4O5 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 2-[[2-(6-nitroimidazo[1,2-a]pyridin-2-yl)acetyl]amino]hexanoic acid |
| SMILES | CCCCC(NC(=O)Cc1cn2cc([N+](=O)[O-])ccc2n1)C(=O)O |
| InChI | InChI=1S/C15H18N4O5/c1-2-3-4-12(15(21)22)17-14(20)7-10-8-18-9-11(19(23)24)5-6-13(18)16-10/h5-6,8-9,12H,2-4,7H2,1H3,(H,17,20)(H,21,22) |
| InChIKey | YVKVHCMKDKETPC-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 126.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|