C20H25N3 — CID 3471606
N-benzyl-6-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine (PubChem CID 3471606) has the molecular formula C20H25N3 and a molecular weight of 307.44 g/mol. Its IUPAC name is N-benzyl-6-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-benzyl-6-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 3471606 |
| Molecular Formula | C20H25N3 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | N-benzyl-6-methyl-2-pentylimidazo[1,2-a]pyridin-3-amine |
| SMILES | CCCCCc1nc2ccc(C)cn2c1NCc1ccccc1 |
| InChI | InChI=1S/C20H25N3/c1-3-4-6-11-18-20(21-14-17-9-7-5-8-10-17)23-15-16(2)12-13-19(23)22-18/h5,7-10,12-13,15,21H,3-4,6,11,14H2,1-2H3 |
| InChIKey | YZUMKXSUPCFQKC-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|