C28H23N3OS — CID 69318527
N-[(4-methoxyphenyl)methyl]-6-methyl-2-[5-(2-phenylethynyl)thiophen-2-yl]imidazo[1,2-a]pyridin-3-amine (PubChem CID 69318527) has the molecular formula C28H23N3OS and a molecular weight of 449.58 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-6-methyl-2-[5-(2-phenylethynyl)thiophen-2-yl]imidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-6-methyl-2-[5-(2-phenylethynyl)thiophen-2-yl]imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 69318527 |
| Molecular Formula | C28H23N3OS |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-6-methyl-2-[5-(2-phenylethynyl)thiophen-2-yl]imidazo[1,2-a]pyridin-3-amine |
| SMILES | COc1ccc(CNc2c(-c3ccc(C#Cc4ccccc4)s3)nc3ccc(C)cn23)cc1 |
| InChI | InChI=1S/C28H23N3OS/c1-20-8-17-26-30-27(25-16-15-24(33-25)14-11-21-6-4-3-5-7-21)28(31(26)19-20)29-18-22-9-12-23(32-2)13-10-22/h3-10,12-13,15-17,19,29H,18H2,1-2H3 |
| InChIKey | XPNFFEZIZAPPAY-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|