C28H29N3S — CID 11626330
N-(cyclohexylmethyl)-5,7-dimethyl-2-[5-(2-phenylethynyl)thiophen-2-yl]imidazo[1,2-a]pyridin-3-amine (PubChem CID 11626330) has the molecular formula C28H29N3S and a molecular weight of 439.63 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-5,7-dimethyl-2-[5-(2-phenylethynyl)thiophen-2-yl]imidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-(cyclohexylmethyl)-5,7-dimethyl-2-[5-(2-phenylethynyl)thiophen-2-yl]imidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 11626330 |
| Molecular Formula | C28H29N3S |
| Molecular Weight | 439.63 g/mol |
| Exact Mass | 439.21 |
| IUPAC Name | N-(cyclohexylmethyl)-5,7-dimethyl-2-[5-(2-phenylethynyl)thiophen-2-yl]imidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1cc(C)n2c(NCC3CCCCC3)c(-c3ccc(C#Cc4ccccc4)s3)nc2c1 |
| InChI | InChI=1S/C28H29N3S/c1-20-17-21(2)31-26(18-20)30-27(28(31)29-19-23-11-7-4-8-12-23)25-16-15-24(32-25)14-13-22-9-5-3-6-10-22/h3,5-6,9-10,15-18,23,29H,4,7-8,11-12,19H2,1-2H3 |
| InChIKey | NKZSRTNFISYRLV-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.63 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|