C18H21N3 — CID 808707
N-benzyl-5-methyl-2-propylimidazo[1,2-a]pyridin-3-amine (PubChem CID 808707) has the molecular formula C18H21N3 and a molecular weight of 279.39 g/mol. Its IUPAC name is N-benzyl-5-methyl-2-propylimidazo[1,2-a]pyridin-3-amine.
| Compound Name | N-benzyl-5-methyl-2-propylimidazo[1,2-a]pyridin-3-amine |
|---|---|
| PubChem CID | 808707 |
| Molecular Formula | C18H21N3 |
| Molecular Weight | 279.39 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | N-benzyl-5-methyl-2-propylimidazo[1,2-a]pyridin-3-amine |
| SMILES | CCCc1nc2cccc(C)n2c1NCc1ccccc1 |
| InChI | InChI=1S/C18H21N3/c1-3-8-16-18(19-13-15-10-5-4-6-11-15)21-14(2)9-7-12-17(21)20-16/h4-7,9-12,19H,3,8,13H2,1-2H3 |
| InChIKey | XXPNNBVVUBBJCW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |