C16H20N4O5 — CID 11950379
3-[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-2-yl]propanoic acid (PubChem CID 11950379) has the molecular formula C16H20N4O5 and a molecular weight of 348.36 g/mol. Its IUPAC name is 3-[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-2-yl]propanoic acid.
| Compound Name | 3-[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-2-yl]propanoic acid |
|---|---|
| PubChem CID | 11950379 |
| Molecular Formula | C16H20N4O5 |
| Molecular Weight | 348.36 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | 3-[6-[(E)-3-(hydroxyamino)-3-oxoprop-1-enyl]-3-(2-methoxyethylamino)imidazo[1,2-a]pyridin-2-yl]propanoic acid |
| SMILES | COCCNc1c(CCC(=O)O)nc2ccc(/C=C/C(=O)NO)cn12 |
| InChI | InChI=1S/C16H20N4O5/c1-25-9-8-17-16-12(4-7-15(22)23)18-13-5-2-11(10-20(13)16)3-6-14(21)19-24/h2-3,5-6,10,17,24H,4,7-9H2,1H3,(H,19,21)(H,22,23)/b6-3+ |
| InChIKey | CJOMGDNSIUOZRC-ZZXKWVIFSA-N |
| XLogP | 0.93 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.36 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|