C23H34N4O4 — CID 146753571
3-[[2-hexyl-7-[(E)-4-hydroxy-3-oxobut-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]-N-(2-methoxyethyl)propanamide (PubChem CID 146753571) has the molecular formula C23H34N4O4 and a molecular weight of 430.55 g/mol. Its IUPAC name is 3-[[2-hexyl-7-[(E)-4-hydroxy-3-oxobut-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]-N-(2-methoxyethyl)propanamide.
| Compound Name | 3-[[2-hexyl-7-[(E)-4-hydroxy-3-oxobut-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]-N-(2-methoxyethyl)propanamide |
|---|---|
| PubChem CID | 146753571 |
| Molecular Formula | C23H34N4O4 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | 3-[[2-hexyl-7-[(E)-4-hydroxy-3-oxobut-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]-N-(2-methoxyethyl)propanamide |
| SMILES | CCCCCCc1nc2cc(/C=C/C(=O)CO)ccn2c1NCCC(=O)NCCOC |
| InChI | InChI=1S/C23H34N4O4/c1-3-4-5-6-7-20-23(25-12-10-22(30)24-13-15-31-2)27-14-11-18(16-21(27)26-20)8-9-19(29)17-28/h8-9,11,14,16,25,28H,3-7,10,12-13,15,17H2,1-2H3,(H,24,30)/b9-8+ |
| InChIKey | RNWHYPNWTKMLSE-CMDGGOBGSA-N |
| XLogP | 2.60 |
| TPSA | 104.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|