C27H43N5O3 — CID 149410441
N-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[[2-hexyl-7-[(E)-4-hydroxy-3-oxobut-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide (PubChem CID 149410441) has the molecular formula C27H43N5O3 and a molecular weight of 485.67 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[[2-hexyl-7-[(E)-4-hydroxy-3-oxobut-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[[2-hexyl-7-[(E)-4-hydroxy-3-oxobut-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide |
|---|---|
| PubChem CID | 149410441 |
| Molecular Formula | C27H43N5O3 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.34 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-3-[[2-hexyl-7-[(E)-4-hydroxy-3-oxobut-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide |
| SMILES | CCCCCCc1nc2cc(/C=C/C(=O)CO)ccn2c1NCCC(=O)NCC(C)(C)CN(C)C |
| InChI | InChI=1S/C27H43N5O3/c1-6-7-8-9-10-23-26(28-15-13-25(35)29-19-27(2,3)20-31(4)5)32-16-14-21(17-24(32)30-23)11-12-22(34)18-33/h11-12,14,16-17,28,33H,6-10,13,15,18-20H2,1-5H3,(H,29,35)/b12-11+ |
| InChIKey | YRDKZBXCWZCPHL-VAWYXSNFSA-N |
| XLogP | 3.54 |
| TPSA | 98.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|