C18H30N2O2 — CID 134008156
N-[3-(dimethylamino)-2,2-dimethylpropyl]-4-(3-methylphenoxy)butanamide (PubChem CID 134008156) has the molecular formula C18H30N2O2 and a molecular weight of 306.45 g/mol. Its IUPAC name is N-[3-(dimethylamino)-2,2-dimethylpropyl]-4-(3-methylphenoxy)butanamide.
| Compound Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-4-(3-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 134008156 |
| Molecular Formula | C18H30N2O2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.23 |
| IUPAC Name | N-[3-(dimethylamino)-2,2-dimethylpropyl]-4-(3-methylphenoxy)butanamide |
| SMILES | Cc1cccc(OCCCC(=O)NCC(C)(C)CN(C)C)c1 |
| InChI | InChI=1S/C18H30N2O2/c1-15-8-6-9-16(12-15)22-11-7-10-17(21)19-13-18(2,3)14-20(4)5/h6,8-9,12H,7,10-11,13-14H2,1-5H3,(H,19,21) |
| InChIKey | QWDLTNVHKBHPEQ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|