C25H42N6O3 — CID 143296704
N-[2-(diethylamino)ethyl]-3-[[2-hexyl-7-[(E)-3-hydroxy-3-(hydroxyamino)prop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide (PubChem CID 143296704) has the molecular formula C25H42N6O3 and a molecular weight of 474.65 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3-[[2-hexyl-7-[(E)-3-hydroxy-3-(hydroxyamino)prop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-3-[[2-hexyl-7-[(E)-3-hydroxy-3-(hydroxyamino)prop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide |
|---|---|
| PubChem CID | 143296704 |
| Molecular Formula | C25H42N6O3 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.33 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3-[[2-hexyl-7-[(E)-3-hydroxy-3-(hydroxyamino)prop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide |
| SMILES | CCCCCCc1nc2cc(/C=C/C(O)NO)ccn2c1NCCC(=O)NCCN(CC)CC |
| InChI | InChI=1S/C25H42N6O3/c1-4-7-8-9-10-21-25(27-15-13-23(32)26-16-18-30(5-2)6-3)31-17-14-20(19-22(31)28-21)11-12-24(33)29-34/h11-12,14,17,19,24,27,29,33-34H,4-10,13,15-16,18H2,1-3H3,(H,26,32)/b12-11+ |
| InChIKey | XAWYDIPLVWOXPY-VAWYXSNFSA-N |
| XLogP | 3.03 |
| TPSA | 114.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|