C25H40N6O3 — CID 73151363
N-[2-(diethylamino)ethyl]-3-[[2-hexyl-7-[3-(hydroxyamino)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide (PubChem CID 73151363) has the molecular formula C25H40N6O3 and a molecular weight of 472.63 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3-[[2-hexyl-7-[3-(hydroxyamino)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-3-[[2-hexyl-7-[3-(hydroxyamino)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide |
|---|---|
| PubChem CID | 73151363 |
| Molecular Formula | C25H40N6O3 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.32 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3-[[2-hexyl-7-[3-(hydroxyamino)-3-oxoprop-1-enyl]imidazo[1,2-a]pyridin-3-yl]amino]propanamide |
| SMILES | CCCCCCc1nc2cc(C=CC(=O)NO)ccn2c1NCCC(=O)NCCN(CC)CC |
| InChI | InChI=1S/C25H40N6O3/c1-4-7-8-9-10-21-25(27-15-13-23(32)26-16-18-30(5-2)6-3)31-17-14-20(19-22(31)28-21)11-12-24(33)29-34/h11-12,14,17,19,27,34H,4-10,13,15-16,18H2,1-3H3,(H,26,32)(H,29,33) |
| InChIKey | BHTOFIODDZWJNH-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 111.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|