C21H33N5O2 — CID 73151454
3-[2-tert-butyl-3-[[2-(diethylamino)ethylamino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide (PubChem CID 73151454) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 3-[2-tert-butyl-3-[[2-(diethylamino)ethylamino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[2-tert-butyl-3-[[2-(diethylamino)ethylamino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 73151454 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | 3-[2-tert-butyl-3-[[2-(diethylamino)ethylamino]methyl]imidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
| SMILES | CCN(CC)CCNCc1c(C(C)(C)C)nc2cc(C=CC(=O)NO)ccn12 |
| InChI | InChI=1S/C21H33N5O2/c1-6-25(7-2)13-11-22-15-17-20(21(3,4)5)23-18-14-16(10-12-26(17)18)8-9-19(27)24-28/h8-10,12,14,22,28H,6-7,11,13,15H2,1-5H3,(H,24,27) |
| InChIKey | SQJDTMZVTGUILD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|