C21H32N4O2 — CID 74423009
3-[3-[[ethyl(3-methylbutyl)amino]methyl]-2-propylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide (PubChem CID 74423009) has the molecular formula C21H32N4O2 and a molecular weight of 372.51 g/mol. Its IUPAC name is 3-[3-[[ethyl(3-methylbutyl)amino]methyl]-2-propylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[3-[[ethyl(3-methylbutyl)amino]methyl]-2-propylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 74423009 |
| Molecular Formula | C21H32N4O2 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.25 |
| IUPAC Name | 3-[3-[[ethyl(3-methylbutyl)amino]methyl]-2-propylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
| SMILES | CCCc1nc2cc(C=CC(=O)NO)ccn2c1CN(CC)CCC(C)C |
| InChI | InChI=1S/C21H32N4O2/c1-5-7-18-19(15-24(6-2)12-10-16(3)4)25-13-11-17(14-20(25)22-18)8-9-21(26)23-27/h8-9,11,13-14,16,27H,5-7,10,12,15H2,1-4H3,(H,23,26) |
| InChIKey | LLIRZQIFVKEHLK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|