C21H24N4O2 — CID 74373213
3-[3-[(tert-butylamino)methyl]-2-phenylimidazo[1,2-a]pyridin-6-yl]-N-hydroxyprop-2-enamide (PubChem CID 74373213) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is 3-[3-[(tert-butylamino)methyl]-2-phenylimidazo[1,2-a]pyridin-6-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[3-[(tert-butylamino)methyl]-2-phenylimidazo[1,2-a]pyridin-6-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 74373213 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | 3-[3-[(tert-butylamino)methyl]-2-phenylimidazo[1,2-a]pyridin-6-yl]-N-hydroxyprop-2-enamide |
| SMILES | CC(C)(C)NCc1c(-c2ccccc2)nc2ccc(C=CC(=O)NO)cn12 |
| InChI | InChI=1S/C21H24N4O2/c1-21(2,3)22-13-17-20(16-7-5-4-6-8-16)23-18-11-9-15(14-25(17)18)10-12-19(26)24-27/h4-12,14,22,27H,13H2,1-3H3,(H,24,26) |
| InChIKey | LLNCDFAOHPFRMT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|