C23H26N4O3 — CID 11951456
(E)-3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-phenylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide (PubChem CID 11951456) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is (E)-3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-phenylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-phenylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 11951456 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | (E)-3-[3-[(2,6-dimethylmorpholin-4-yl)methyl]-2-phenylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
| SMILES | CC1CN(Cc2c(-c3ccccc3)nc3cc(/C=C/C(=O)NO)ccn23)CC(C)O1 |
| InChI | InChI=1S/C23H26N4O3/c1-16-13-26(14-17(2)30-16)15-20-23(19-6-4-3-5-7-19)24-21-12-18(10-11-27(20)21)8-9-22(28)25-29/h3-12,16-17,29H,13-15H2,1-2H3,(H,25,28)/b9-8+ |
| InChIKey | XDVMGGPRPCCMQN-CMDGGOBGSA-N |
| XLogP | 3.13 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|