C22H25N3O4 — CID 55801432
(E)-N-[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 55801432) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is (E)-N-[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 55801432 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | (E)-N-[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | CC1CN(Cc2ccccc2NC(=O)/C=C/c2cccc([N+](=O)[O-])c2)CC(C)O1 |
| InChI | InChI=1S/C22H25N3O4/c1-16-13-24(14-17(2)29-16)15-19-7-3-4-9-21(19)23-22(26)11-10-18-6-5-8-20(12-18)25(27)28/h3-12,16-17H,13-15H2,1-2H3,(H,23,26)/b11-10+ |
| InChIKey | GWZWAAZPINLHLV-ZHACJKMWSA-N |
| XLogP | 3.86 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|