C20H23IN2O2 — CID 55801490
N-[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]-3-iodobenzamide (PubChem CID 55801490) has the molecular formula C20H23IN2O2 and a molecular weight of 450.32 g/mol. Its IUPAC name is N-[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]-3-iodobenzamide.
| Compound Name | N-[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 55801490 |
| Molecular Formula | C20H23IN2O2 |
| Molecular Weight | 450.32 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | N-[2-[(2,6-dimethylmorpholin-4-yl)methyl]phenyl]-3-iodobenzamide |
| SMILES | CC1CN(Cc2ccccc2NC(=O)c2cccc(I)c2)CC(C)O1 |
| InChI | InChI=1S/C20H23IN2O2/c1-14-11-23(12-15(2)25-14)13-17-6-3-4-9-19(17)22-20(24)16-7-5-8-18(21)10-16/h3-10,14-15H,11-13H2,1-2H3,(H,22,24) |
| InChIKey | IFPTZGHFENARES-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.32 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|