C29H30N4O2 — CID 11951459
(E)-3-[3-[(4-benzylpiperidin-1-yl)methyl]-2-phenylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide (PubChem CID 11951459) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is (E)-3-[3-[(4-benzylpiperidin-1-yl)methyl]-2-phenylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide.
| Compound Name | (E)-3-[3-[(4-benzylpiperidin-1-yl)methyl]-2-phenylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 11951459 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | (E)-3-[3-[(4-benzylpiperidin-1-yl)methyl]-2-phenylimidazo[1,2-a]pyridin-7-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(/C=C/c1ccn2c(CN3CCC(Cc4ccccc4)CC3)c(-c3ccccc3)nc2c1)NO |
| InChI | InChI=1S/C29H30N4O2/c34-28(31-35)12-11-23-15-18-33-26(29(30-27(33)20-23)25-9-5-2-6-10-25)21-32-16-13-24(14-17-32)19-22-7-3-1-4-8-22/h1-12,15,18,20,24,35H,13-14,16-17,19,21H2,(H,31,34)/b12-11+ |
| InChIKey | IQAREKMHZINKKU-VAWYXSNFSA-N |
| XLogP | 4.97 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|