C20H33BrN2O2 — CID 141242145
1-(2-bromoacetyl)-N,N-dicyclohexylpiperidine-4-carboxamide (PubChem CID 141242145) has the molecular formula C20H33BrN2O2 and a molecular weight of 413.40 g/mol. Its IUPAC name is 1-(2-bromoacetyl)-N,N-dicyclohexylpiperidine-4-carboxamide.
| Compound Name | 1-(2-bromoacetyl)-N,N-dicyclohexylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 141242145 |
| Molecular Formula | C20H33BrN2O2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-(2-bromoacetyl)-N,N-dicyclohexylpiperidine-4-carboxamide |
| SMILES | O=C(CBr)N1CCC(C(=O)N(C2CCCCC2)C2CCCCC2)CC1 |
| InChI | InChI=1S/C20H33BrN2O2/c21-15-19(24)22-13-11-16(12-14-22)20(25)23(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h16-18H,1-15H2 |
| InChIKey | AHMRJTQCPCEXMC-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|