C22H19Cl2N3OS — CID 141242370
2-[2-(3-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-N-[(2-chlorophenyl)methylideneamino]acetamide (PubChem CID 141242370) has the molecular formula C22H19Cl2N3OS and a molecular weight of 444.39 g/mol. Its IUPAC name is 2-[2-(3-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-N-[(2-chlorophenyl)methylideneamino]acetamide.
| Compound Name | 2-[2-(3-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-N-[(2-chlorophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 141242370 |
| Molecular Formula | C22H19Cl2N3OS |
| Molecular Weight | 444.39 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 2-[2-(3-chlorophenyl)-6,7-dihydro-4H-thieno[3,2-c]pyridin-5-yl]-N-[(2-chlorophenyl)methylideneamino]acetamide |
| SMILES | O=C(CN1CCc2sc(-c3cccc(Cl)c3)cc2C1)NN=Cc1ccccc1Cl |
| InChI | InChI=1S/C22H19Cl2N3OS/c23-18-6-3-5-15(10-18)21-11-17-13-27(9-8-20(17)29-21)14-22(28)26-25-12-16-4-1-2-7-19(16)24/h1-7,10-12H,8-9,13-14H2,(H,26,28) |
| InChIKey | VEBWHBRWZYCPDI-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.39 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|