About dipyridin-2-ylazanium;trifluoromethanesulfonate
dipyridin-2-ylazanium;trifluoromethanesulfonate (PubChem CID 141243454) has the molecular formula C11H10F3N3O3S
and a molecular weight of 321.28 g/mol. Its IUPAC name is dipyridin-2-ylazanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | dipyridin-2-ylazanium;trifluoromethanesulfonate |
| PubChem CID | 141243454 |
| Molecular Formula | C11H10F3N3O3S |
| Molecular Weight | 321.28 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | dipyridin-2-ylazanium;trifluoromethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)F.c1ccc([NH2+]c2ccccn2)nc1 |
| InChI | InChI=1S/C10H9N3.CHF3O3S/c1-3-7-11-9(5-1)13-10-6-2-4-8-12-10;2-1(3,4)8(5,6)7/h1-8H,(H,11,12,13);(H,5,6,7) |
| InChIKey | RGEHCYBBIKCEFZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 99.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.28 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze dipyridin-2-ylazanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dipyridin-2-ylazanium;trifluoromethanesulfonate?
The IUPAC name of dipyridin-2-ylazanium;trifluoromethanesulfonate (CID 141243454) is dipyridin-2-ylazanium;trifluoromethanesulfonate.
What is the SMILES notation for dipyridin-2-ylazanium;trifluoromethanesulfonate?
The canonical SMILES for dipyridin-2-ylazanium;trifluoromethanesulfonate is O=S(=O)([O-])C(F)(F)F.c1ccc([NH2+]c2ccccn2)nc1.
What is the InChIKey of dipyridin-2-ylazanium;trifluoromethanesulfonate?
The InChIKey is RGEHCYBBIKCEFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3.CHF3O3S/c1-3-7-11-9(5-1)13-10-6-2-4-8-12-10;2-1(3,4)8(5,6)7/h1-8H,(H,11,12,13);(H,5,6,7).
What are the key properties of dipyridin-2-ylazanium;trifluoromethanesulfonate?
dipyridin-2-ylazanium;trifluoromethanesulfonate has a molecular weight of 321.28 g/mol, XLogP of 1.05, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dipyridin-2-ylazanium;trifluoromethanesulfonate is sourced from PubChem (CID 141243454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).