C26H48O2 — CID 141243502
(1,2,2,3-tetrabutylcyclohexyl) 2-methylprop-2-enoate (PubChem CID 141243502) has the molecular formula C26H48O2 and a molecular weight of 392.67 g/mol. Its IUPAC name is (1,2,2,3-tetrabutylcyclohexyl) 2-methylprop-2-enoate.
| Compound Name | (1,2,2,3-tetrabutylcyclohexyl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141243502 |
| Molecular Formula | C26H48O2 |
| Molecular Weight | 392.67 g/mol |
| Exact Mass | 392.37 |
| IUPAC Name | (1,2,2,3-tetrabutylcyclohexyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1(CCCC)CCCC(CCCC)C1(CCCC)CCCC |
| InChI | InChI=1S/C26H48O2/c1-7-11-16-23-17-15-21-26(20-14-10-4,28-24(27)22(5)6)25(23,18-12-8-2)19-13-9-3/h23H,5,7-21H2,1-4,6H3 |
| InChIKey | VZTQLNUROZIKDL-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.67 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|