C16H28O8 — CID 91559865
carboxyoxyperoxy (1,2-dibutylcyclohexyl) carbonate (PubChem CID 91559865) has the molecular formula C16H28O8 and a molecular weight of 348.39 g/mol. Its IUPAC name is carboxyoxyperoxy (1,2-dibutylcyclohexyl) carbonate.
| Compound Name | carboxyoxyperoxy (1,2-dibutylcyclohexyl) carbonate |
|---|---|
| PubChem CID | 91559865 |
| Molecular Formula | C16H28O8 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | carboxyoxyperoxy (1,2-dibutylcyclohexyl) carbonate |
| SMILES | CCCCC1CCCCC1(CCCC)OC(=O)OOOOC(=O)O |
| InChI | InChI=1S/C16H28O8/c1-3-5-9-13-10-7-8-12-16(13,11-6-4-2)20-15(19)22-24-23-21-14(17)18/h13H,3-12H2,1-2H3,(H,17,18) |
| InChIKey | OOAJSUFYKYWXFQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|