C14H24O3 — CID 58734591
(1-butyl-2-methoxycyclohexyl) prop-2-enoate (PubChem CID 58734591) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (1-butyl-2-methoxycyclohexyl) prop-2-enoate.
| Compound Name | (1-butyl-2-methoxycyclohexyl) prop-2-enoate |
|---|---|
| PubChem CID | 58734591 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (1-butyl-2-methoxycyclohexyl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(CCCC)CCCCC1OC |
| InChI | InChI=1S/C14H24O3/c1-4-6-10-14(17-13(15)5-2)11-8-7-9-12(14)16-3/h5,12H,2,4,6-11H2,1,3H3 |
| InChIKey | JUMORQQJPYHTJP-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|