C16H26O2 — CID 164546613
(1-pentyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl) prop-2-enoate (PubChem CID 164546613) has the molecular formula C16H26O2 and a molecular weight of 250.38 g/mol. Its IUPAC name is (1-pentyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl) prop-2-enoate.
| Compound Name | (1-pentyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl) prop-2-enoate |
|---|---|
| PubChem CID | 164546613 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | (1-pentyl-3,3a,4,5,6,6a-hexahydro-2H-pentalen-1-yl) prop-2-enoate |
| SMILES | C=CC(=O)OC1(CCCCC)CCC2CCCC21 |
| InChI | InChI=1S/C16H26O2/c1-3-5-6-11-16(18-15(17)4-2)12-10-13-8-7-9-14(13)16/h4,13-14H,2-3,5-12H2,1H3 |
| InChIKey | OSGDZKNRUZALSG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|